C11H15ClN4O4S — CID 119382164
4-[2-(2-aminoethylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide;hydrochloride (PubChem CID 119382164) has the molecular formula C11H15ClN4O4S and a molecular weight of 334.79 g/mol. Its IUPAC name is 4-[2-(2-aminoethylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide;hydrochloride.
| Compound Name | 4-[2-(2-aminoethylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119382164 |
| Molecular Formula | C11H15ClN4O4S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4-[2-(2-aminoethylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)CSc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N4O4S.ClH/c12-3-4-14-10(16)6-20-9-2-1-7(11(13)17)5-8(9)15(18)19;/h1-2,5H,3-4,6,12H2,(H2,13,17)(H,14,16);1H |
| InChIKey | UFHHFMCAYQCWFB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|