C15H12N4O6S — CID 43025503
3-nitro-4-[2-(4-nitroanilino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 43025503) has the molecular formula C15H12N4O6S and a molecular weight of 376.35 g/mol. Its IUPAC name is 3-nitro-4-[2-(4-nitroanilino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | 3-nitro-4-[2-(4-nitroanilino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 43025503 |
| Molecular Formula | C15H12N4O6S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 3-nitro-4-[2-(4-nitroanilino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | NC(=O)c1ccc(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12N4O6S/c16-15(21)9-1-6-13(12(7-9)19(24)25)26-8-14(20)17-10-2-4-11(5-3-10)18(22)23/h1-7H,8H2,(H2,16,21)(H,17,20) |
| InChIKey | ODLINQWGSAJPJA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|