C16H13N3O6S — CID 26908207
4-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide (PubChem CID 26908207) has the molecular formula C16H13N3O6S and a molecular weight of 375.36 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide.
| Compound Name | 4-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26908207 |
| Molecular Formula | C16H13N3O6S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)OCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13N3O6S/c17-16(21)9-1-4-14(11(5-9)19(22)23)26-7-15(20)18-10-2-3-12-13(6-10)25-8-24-12/h1-6H,7-8H2,(H2,17,21)(H,18,20) |
| InChIKey | GWCWGLPOOHCCDR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|