C20H22N4O5S — CID 55708109
4-[2-[2-methyl-5-(2-methylpropanoylamino)anilino]-2-oxoethyl]sulfanyl-3-nitrobenzamide (PubChem CID 55708109) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is 4-[2-[2-methyl-5-(2-methylpropanoylamino)anilino]-2-oxoethyl]sulfanyl-3-nitrobenzamide.
| Compound Name | 4-[2-[2-methyl-5-(2-methylpropanoylamino)anilino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 55708109 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 4-[2-[2-methyl-5-(2-methylpropanoylamino)anilino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)C(C)C)cc1NC(=O)CSc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O5S/c1-11(2)20(27)22-14-6-4-12(3)15(9-14)23-18(25)10-30-17-7-5-13(19(21)26)8-16(17)24(28)29/h4-9,11H,10H2,1-3H3,(H2,21,26)(H,22,27)(H,23,25) |
| InChIKey | JIFDZMPOGXNEHX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|