C15H19N3O6S — CID 119212178
2-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]-3-methylpentanoic acid (PubChem CID 119212178) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119212178 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CSc1ccc(C(N)=O)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C15H19N3O6S/c1-3-8(2)13(15(21)22)17-12(19)7-25-11-5-4-9(14(16)20)6-10(11)18(23)24/h4-6,8,13H,3,7H2,1-2H3,(H2,16,20)(H,17,19)(H,21,22) |
| InChIKey | ITWFMCAVOXSCBF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|