C24H22N4O5S — CID 42996357
3-nitro-4-[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl]sulfanylbenzamide (PubChem CID 42996357) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is 3-nitro-4-[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl]sulfanylbenzamide.
| Compound Name | 3-nitro-4-[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 42996357 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-nitro-4-[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl]sulfanylbenzamide |
| SMILES | CC(NC(=O)c1ccccc1NC(=O)CSc1ccc(C(N)=O)cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C24H22N4O5S/c1-15(16-7-3-2-4-8-16)26-24(31)18-9-5-6-10-19(18)27-22(29)14-34-21-12-11-17(23(25)30)13-20(21)28(32)33/h2-13,15H,14H2,1H3,(H2,25,30)(H,26,31)(H,27,29) |
| InChIKey | MYTMMKWKBFIXNU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|