C18H17ClFN3O4S — CID 86948999
4-[2-[2-(2-chloro-4-fluorophenyl)propan-2-ylamino]-2-oxoethyl]sulfanyl-3-nitrobenzamide (PubChem CID 86948999) has the molecular formula C18H17ClFN3O4S and a molecular weight of 425.87 g/mol. Its IUPAC name is 4-[2-[2-(2-chloro-4-fluorophenyl)propan-2-ylamino]-2-oxoethyl]sulfanyl-3-nitrobenzamide.
| Compound Name | 4-[2-[2-(2-chloro-4-fluorophenyl)propan-2-ylamino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 86948999 |
| Molecular Formula | C18H17ClFN3O4S |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4-[2-[2-(2-chloro-4-fluorophenyl)propan-2-ylamino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
| SMILES | CC(C)(NC(=O)CSc1ccc(C(N)=O)cc1[N+](=O)[O-])c1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H17ClFN3O4S/c1-18(2,12-5-4-11(20)8-13(12)19)22-16(24)9-28-15-6-3-10(17(21)25)7-14(15)23(26)27/h3-8H,9H2,1-2H3,(H2,21,25)(H,22,24) |
| InChIKey | ZFSYIACMFLOUMD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|