C11H10NO6S- — CID 3490941
4-(2-ethoxy-2-oxoethyl)sulfanyl-3-nitrobenzoate (PubChem CID 3490941) has the molecular formula C11H10NO6S- and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-(2-ethoxy-2-oxoethyl)sulfanyl-3-nitrobenzoate.
| Compound Name | 4-(2-ethoxy-2-oxoethyl)sulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 3490941 |
| Molecular Formula | C11H10NO6S- |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 4-(2-ethoxy-2-oxoethyl)sulfanyl-3-nitrobenzoate |
| SMILES | CCOC(=O)CSc1ccc(C(=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11NO6S/c1-2-18-10(13)6-19-9-4-3-7(11(14)15)5-8(9)12(16)17/h3-5H,2,6H2,1H3,(H,14,15)/p-1 |
| InChIKey | JFFSVJCOFFOCKB-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 109.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|