C10H10F3NO2S — CID 61320071
3-[2-amino-4-(trifluoromethyl)phenyl]sulfanylpropanoic acid (PubChem CID 61320071) has the molecular formula C10H10F3NO2S and a molecular weight of 265.26 g/mol. Its IUPAC name is 3-[2-amino-4-(trifluoromethyl)phenyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-amino-4-(trifluoromethyl)phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 61320071 |
| Molecular Formula | C10H10F3NO2S |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 3-[2-amino-4-(trifluoromethyl)phenyl]sulfanylpropanoic acid |
| SMILES | Nc1cc(C(F)(F)F)ccc1SCCC(=O)O |
| InChI | InChI=1S/C10H10F3NO2S/c11-10(12,13)6-1-2-8(7(14)5-6)17-4-3-9(15)16/h1-2,5H,3-4,14H2,(H,15,16) |
| InChIKey | ASOHIUKGSQPTCZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|