C23H20BrF3N2O4 — CID 153326914
methyl (E)-2-[2-[[1-benzyl-5-bromo-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 153326914) has the molecular formula C23H20BrF3N2O4 and a molecular weight of 525.32 g/mol. Its IUPAC name is methyl (E)-2-[2-[[1-benzyl-5-bromo-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[1-benzyl-5-bromo-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 153326914 |
| Molecular Formula | C23H20BrF3N2O4 |
| Molecular Weight | 525.32 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | methyl (E)-2-[2-[[1-benzyl-5-bromo-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1nn(Cc2ccccc2)c(Br)c1C(F)(F)F |
| InChI | InChI=1S/C23H20BrF3N2O4/c1-31-14-18(22(30)32-2)17-11-7-6-10-16(17)13-33-21-19(23(25,26)27)20(24)29(28-21)12-15-8-4-3-5-9-15/h3-11,14H,12-13H2,1-2H3/b18-14+ |
| InChIKey | YKSMMCIVKBHBAH-NBVRZTHBSA-N |
| XLogP | 5.45 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|