C22H23BrF3N3O6 — CID 153326963
methyl (E)-2-[2-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 153326963) has the molecular formula C22H23BrF3N3O6 and a molecular weight of 562.34 g/mol. Its IUPAC name is methyl (E)-2-[2-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 153326963 |
| Molecular Formula | C22H23BrF3N3O6 |
| Molecular Weight | 562.34 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | methyl (E)-2-[2-[[5-bromo-1-(2-morpholin-4-yl-2-oxoethyl)-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1nn(CC(=O)N2CCOCC2)c(Br)c1C(F)(F)F |
| InChI | InChI=1S/C22H23BrF3N3O6/c1-32-13-16(21(31)33-2)15-6-4-3-5-14(15)12-35-20-18(22(24,25)26)19(23)29(27-20)11-17(30)28-7-9-34-10-8-28/h3-6,13H,7-12H2,1-2H3/b16-13+ |
| InChIKey | LBHDXZFTEQPGND-DTQAZKPQSA-N |
| XLogP | 3.26 |
| TPSA | 92.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|