C22H24ClNO5 — CID 11546205
methyl (E)-2-[4-chloro-2-[(3-morpholin-4-ylphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 11546205) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is methyl (E)-2-[4-chloro-2-[(3-morpholin-4-ylphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[4-chloro-2-[(3-morpholin-4-ylphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 11546205 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | methyl (E)-2-[4-chloro-2-[(3-morpholin-4-ylphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccc(Cl)cc1COc1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C22H24ClNO5/c1-26-15-21(22(25)27-2)20-7-6-17(23)12-16(20)14-29-19-5-3-4-18(13-19)24-8-10-28-11-9-24/h3-7,12-13,15H,8-11,14H2,1-2H3/b21-15+ |
| InChIKey | JHYLUCBPSQPHRE-RCCKNPSSSA-N |
| XLogP | 3.92 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|