C25H24ClNO4 — CID 11561204
methyl (E)-2-[4-chloro-2-[[3-(N-methylanilino)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 11561204) has the molecular formula C25H24ClNO4 and a molecular weight of 437.92 g/mol. Its IUPAC name is methyl (E)-2-[4-chloro-2-[[3-(N-methylanilino)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[4-chloro-2-[[3-(N-methylanilino)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 11561204 |
| Molecular Formula | C25H24ClNO4 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | methyl (E)-2-[4-chloro-2-[[3-(N-methylanilino)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccc(Cl)cc1COc1cccc(N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C25H24ClNO4/c1-27(20-8-5-4-6-9-20)21-10-7-11-22(15-21)31-16-18-14-19(26)12-13-23(18)24(17-29-2)25(28)30-3/h4-15,17H,16H2,1-3H3/b24-17+ |
| InChIKey | AQMOOXUHDGDLOU-JJIBRWJFSA-N |
| XLogP | 5.85 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|