C26H25ClO4 — CID 143156873
methyl (E)-2-[4-chloro-2-[[3-(1-phenylethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 143156873) has the molecular formula C26H25ClO4 and a molecular weight of 436.94 g/mol. Its IUPAC name is methyl (E)-2-[4-chloro-2-[[3-(1-phenylethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[4-chloro-2-[[3-(1-phenylethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 143156873 |
| Molecular Formula | C26H25ClO4 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | methyl (E)-2-[4-chloro-2-[[3-(1-phenylethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccc(Cl)cc1COc1cccc(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H25ClO4/c1-18(19-8-5-4-6-9-19)20-10-7-11-23(15-20)31-16-21-14-22(27)12-13-24(21)25(17-29-2)26(28)30-3/h4-15,17-18H,16H2,1-3H3/b25-17+ |
| InChIKey | VTQPUFVBQQELEZ-KOEQRZSOSA-N |
| XLogP | 6.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|