C22H24ClNO5 — CID 141128501
(E)-2-[4-chloro-2-[(3-morpholin-4-ylphenoxy)methyl]phenyl]-3-methoxybut-2-enoic acid (PubChem CID 141128501) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is (E)-2-[4-chloro-2-[(3-morpholin-4-ylphenoxy)methyl]phenyl]-3-methoxybut-2-enoic acid.
| Compound Name | (E)-2-[4-chloro-2-[(3-morpholin-4-ylphenoxy)methyl]phenyl]-3-methoxybut-2-enoic acid |
|---|---|
| PubChem CID | 141128501 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (E)-2-[4-chloro-2-[(3-morpholin-4-ylphenoxy)methyl]phenyl]-3-methoxybut-2-enoic acid |
| SMILES | CO/C(C)=C(/C(=O)O)c1ccc(Cl)cc1COc1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C22H24ClNO5/c1-15(27-2)21(22(25)26)20-7-6-17(23)12-16(20)14-29-19-5-3-4-18(13-19)24-8-10-28-11-9-24/h3-7,12-13H,8-11,14H2,1-2H3,(H,25,26)/b21-15+ |
| InChIKey | ZNNUKVOEDVMUCU-RCCKNPSSSA-N |
| XLogP | 4.22 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|