C17H14ClNO3 — CID 117182146
3-[(3-chlorophenoxy)methyl]-1-methylindole-7-carboxylic acid (PubChem CID 117182146) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is 3-[(3-chlorophenoxy)methyl]-1-methylindole-7-carboxylic acid.
| Compound Name | 3-[(3-chlorophenoxy)methyl]-1-methylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 117182146 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-[(3-chlorophenoxy)methyl]-1-methylindole-7-carboxylic acid |
| SMILES | Cn1cc(COc2cccc(Cl)c2)c2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C17H14ClNO3/c1-19-9-11(10-22-13-5-2-4-12(18)8-13)14-6-3-7-15(16(14)19)17(20)21/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | HOPUTTVGNNTYGR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |