4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid

C11H8ClNO3S — CID 117216468

IUPAC4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid
SMILESO=C(O)c1sncc1COc1cccc(Cl)c1
InChIInChI=1S/C11H8ClNO3S/c12-8-2-1-3-9(4-8)16-6-7-5-13-17-10(7)11(14)15/h1-5H,6H2,(H,14,15)
InChIKeyFHXVTZFSLVVWSY-UHFFFAOYSA-N
MW269.71 g/mol
LogP3.07
Rot. Bonds4

About 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid

4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid (PubChem CID 117216468) has the molecular formula C11H8ClNO3S and a molecular weight of 269.71 g/mol. Its IUPAC name is 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid
PubChem CID117216468
Molecular FormulaC11H8ClNO3S
Molecular Weight269.71 g/mol
Exact Mass268.99
IUPAC Name4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid
SMILESO=C(O)c1sncc1COc1cccc(Cl)c1
InChIInChI=1S/C11H8ClNO3S/c12-8-2-1-3-9(4-8)16-6-7-5-13-17-10(7)11(14)15/h1-5H,6H2,(H,14,15)
InChIKeyFHXVTZFSLVVWSY-UHFFFAOYSA-N
XLogP3.07
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.71
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid?
The IUPAC name of 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid (CID 117216468) is 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid?
The canonical SMILES for 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid is O=C(O)c1sncc1COc1cccc(Cl)c1.
What is the InChIKey of 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid?
The InChIKey is FHXVTZFSLVVWSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO3S/c12-8-2-1-3-9(4-8)16-6-7-5-13-17-10(7)11(14)15/h1-5H,6H2,(H,14,15).
What are the key properties of 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid?
4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid has a molecular weight of 269.71 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-chlorophenoxy)methyl]-1,2-thiazole-5-carboxylic acid is sourced from PubChem (CID 117216468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).