C15H10ClF3O2 — CID 134105100
1-[2-[(3-chlorophenoxy)methyl]phenyl]-2,2,2-trifluoroethanone (PubChem CID 134105100) has the molecular formula C15H10ClF3O2 and a molecular weight of 314.69 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenoxy)methyl]phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-[(3-chlorophenoxy)methyl]phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 134105100 |
| Molecular Formula | C15H10ClF3O2 |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-[2-[(3-chlorophenoxy)methyl]phenyl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccccc1COc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C15H10ClF3O2/c16-11-5-3-6-12(8-11)21-9-10-4-1-2-7-13(10)14(20)15(17,18)19/h1-8H,9H2 |
| InChIKey | RXZIPCKRJDWYRS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |