C13H9ClF2O — CID 60975597
2-[(3-chlorophenoxy)methyl]-1,4-difluorobenzene (PubChem CID 60975597) has the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. Its IUPAC name is 2-[(3-chlorophenoxy)methyl]-1,4-difluorobenzene.
| Compound Name | 2-[(3-chlorophenoxy)methyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 60975597 |
| Molecular Formula | C13H9ClF2O |
| Molecular Weight | 254.66 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-[(3-chlorophenoxy)methyl]-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(COc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C13H9ClF2O/c14-10-2-1-3-12(7-10)17-8-9-6-11(15)4-5-13(9)16/h1-7H,8H2 |
| InChIKey | LQCGURAJIBBWOG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |