C16H12ClFO2 — CID 103049220
3-[3-[(5-chloro-2-fluorophenyl)methoxy]phenyl]prop-2-yn-1-ol (PubChem CID 103049220) has the molecular formula C16H12ClFO2 and a molecular weight of 290.72 g/mol. Its IUPAC name is 3-[3-[(5-chloro-2-fluorophenyl)methoxy]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-[(5-chloro-2-fluorophenyl)methoxy]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 103049220 |
| Molecular Formula | C16H12ClFO2 |
| Molecular Weight | 290.72 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-[3-[(5-chloro-2-fluorophenyl)methoxy]phenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1cccc(OCc2cc(Cl)ccc2F)c1 |
| InChI | InChI=1S/C16H12ClFO2/c17-14-6-7-16(18)13(10-14)11-20-15-5-1-3-12(9-15)4-2-8-19/h1,3,5-7,9-10,19H,8,11H2 |
| InChIKey | VHZHBVNCBSCOHV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|