C17H14F2O2 — CID 82915423
4-[3-[(3,4-difluorophenyl)methoxy]phenyl]but-3-yn-1-ol (PubChem CID 82915423) has the molecular formula C17H14F2O2 and a molecular weight of 288.29 g/mol. Its IUPAC name is 4-[3-[(3,4-difluorophenyl)methoxy]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-[(3,4-difluorophenyl)methoxy]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 82915423 |
| Molecular Formula | C17H14F2O2 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-[3-[(3,4-difluorophenyl)methoxy]phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cccc(OCc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H14F2O2/c18-16-8-7-14(11-17(16)19)12-21-15-6-3-5-13(10-15)4-1-2-9-20/h3,5-8,10-11,20H,2,9,12H2 |
| InChIKey | FJBOWSSKSFHEER-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|