C15H14F2O2 — CID 112842348
2-[(2-ethoxyphenoxy)methyl]-1,4-difluorobenzene (PubChem CID 112842348) has the molecular formula C15H14F2O2 and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-[(2-ethoxyphenoxy)methyl]-1,4-difluorobenzene.
| Compound Name | 2-[(2-ethoxyphenoxy)methyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 112842348 |
| Molecular Formula | C15H14F2O2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[(2-ethoxyphenoxy)methyl]-1,4-difluorobenzene |
| SMILES | CCOc1ccccc1OCc1cc(F)ccc1F |
| InChI | InChI=1S/C15H14F2O2/c1-2-18-14-5-3-4-6-15(14)19-10-11-9-12(16)7-8-13(11)17/h3-9H,2,10H2,1H3 |
| InChIKey | HDFCGCNMWTXZDA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |