C18H21N3O4 — CID 68662271
[2-amino-5-(3-morpholin-4-ylphenoxy)phenyl]methylcarbamic acid (PubChem CID 68662271) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-amino-5-(3-morpholin-4-ylphenoxy)phenyl]methylcarbamic acid.
| Compound Name | [2-amino-5-(3-morpholin-4-ylphenoxy)phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 68662271 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [2-amino-5-(3-morpholin-4-ylphenoxy)phenyl]methylcarbamic acid |
| SMILES | Nc1ccc(Oc2cccc(N3CCOCC3)c2)cc1CNC(=O)O |
| InChI | InChI=1S/C18H21N3O4/c19-17-5-4-16(10-13(17)12-20-18(22)23)25-15-3-1-2-14(11-15)21-6-8-24-9-7-21/h1-5,10-11,20H,6-9,12,19H2,(H,22,23) |
| InChIKey | YDKOITOPTIVONX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|