C10H17N3O5S — CID 70192799
4-morpholin-4-ylbenzene-1,2-diamine;sulfuric acid (PubChem CID 70192799) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-morpholin-4-ylbenzene-1,2-diamine;sulfuric acid.
| Compound Name | 4-morpholin-4-ylbenzene-1,2-diamine;sulfuric acid |
|---|---|
| PubChem CID | 70192799 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-morpholin-4-ylbenzene-1,2-diamine;sulfuric acid |
| SMILES | Nc1ccc(N2CCOCC2)cc1N.O=S(=O)(O)O |
| InChI | InChI=1S/C10H15N3O.H2O4S/c11-9-2-1-8(7-10(9)12)13-3-5-14-6-4-13;1-5(2,3)4/h1-2,7H,3-6,11-12H2;(H2,1,2,3,4) |
| InChIKey | IUZPDGNPJVLBAW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|