C11H17N3O2 — CID 106751224
[4-(3,4-diaminophenyl)morpholin-3-yl]methanol (PubChem CID 106751224) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is [4-(3,4-diaminophenyl)morpholin-3-yl]methanol.
| Compound Name | [4-(3,4-diaminophenyl)morpholin-3-yl]methanol |
|---|---|
| PubChem CID | 106751224 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | [4-(3,4-diaminophenyl)morpholin-3-yl]methanol |
| SMILES | Nc1ccc(N2CCOCC2CO)cc1N |
| InChI | InChI=1S/C11H17N3O2/c12-10-2-1-8(5-11(10)13)14-3-4-16-7-9(14)6-15/h1-2,5,9,15H,3-4,6-7,12-13H2 |
| InChIKey | WBPVBXVKOHMHSZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|