C14H17N5O2 — CID 174854096
[(3R)-4-[4-(1,3,5-triazin-2-ylamino)phenyl]morpholin-3-yl]methanol (PubChem CID 174854096) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is [(3R)-4-[4-(1,3,5-triazin-2-ylamino)phenyl]morpholin-3-yl]methanol.
| Compound Name | [(3R)-4-[4-(1,3,5-triazin-2-ylamino)phenyl]morpholin-3-yl]methanol |
|---|---|
| PubChem CID | 174854096 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | [(3R)-4-[4-(1,3,5-triazin-2-ylamino)phenyl]morpholin-3-yl]methanol |
| SMILES | OC[C@@H]1COCCN1c1ccc(Nc2ncncn2)cc1 |
| InChI | InChI=1S/C14H17N5O2/c20-7-13-8-21-6-5-19(13)12-3-1-11(2-4-12)18-14-16-9-15-10-17-14/h1-4,9-10,13,20H,5-8H2,(H,15,16,17,18)/t13-/m1/s1 |
| InChIKey | LTQRFCVUINGPMD-CYBMUJFWSA-N |
| XLogP | 0.81 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |