C13H21N3O3 — CID 123202839
4-[4-[(3-amino-2-hydroxypropyl)amino]phenyl]morpholin-3-ol (PubChem CID 123202839) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[4-[(3-amino-2-hydroxypropyl)amino]phenyl]morpholin-3-ol.
| Compound Name | 4-[4-[(3-amino-2-hydroxypropyl)amino]phenyl]morpholin-3-ol |
|---|---|
| PubChem CID | 123202839 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-[4-[(3-amino-2-hydroxypropyl)amino]phenyl]morpholin-3-ol |
| SMILES | NCC(O)CNc1ccc(N2CCOCC2O)cc1 |
| InChI | InChI=1S/C13H21N3O3/c14-7-12(17)8-15-10-1-3-11(4-2-10)16-5-6-19-9-13(16)18/h1-4,12-13,15,17-18H,5-9,14H2 |
| InChIKey | ZLWOEAAATVDUQP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |