C16H26N2O3 — CID 81093843
N-(2,2-diethoxyethyl)-4-morpholin-4-ylaniline (PubChem CID 81093843) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-4-morpholin-4-ylaniline.
| Compound Name | N-(2,2-diethoxyethyl)-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 81093843 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-(2,2-diethoxyethyl)-4-morpholin-4-ylaniline |
| SMILES | CCOC(CNc1ccc(N2CCOCC2)cc1)OCC |
| InChI | InChI=1S/C16H26N2O3/c1-3-20-16(21-4-2)13-17-14-5-7-15(8-6-14)18-9-11-19-12-10-18/h5-8,16-17H,3-4,9-13H2,1-2H3 |
| InChIKey | DIRNCOCTPLQEOT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|