C32H33N3O3 — CID 123546223
4-[4-[[(2S)-4-(4-aminophenyl)-2-hydroxy-4,4-diphenylbutyl]amino]phenyl]morpholin-3-one (PubChem CID 123546223) has the molecular formula C32H33N3O3 and a molecular weight of 507.63 g/mol. Its IUPAC name is 4-[4-[[(2S)-4-(4-aminophenyl)-2-hydroxy-4,4-diphenylbutyl]amino]phenyl]morpholin-3-one.
| Compound Name | 4-[4-[[(2S)-4-(4-aminophenyl)-2-hydroxy-4,4-diphenylbutyl]amino]phenyl]morpholin-3-one |
|---|---|
| PubChem CID | 123546223 |
| Molecular Formula | C32H33N3O3 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 4-[4-[[(2S)-4-(4-aminophenyl)-2-hydroxy-4,4-diphenylbutyl]amino]phenyl]morpholin-3-one |
| SMILES | Nc1ccc(C(C[C@H](O)CNc2ccc(N3CCOCC3=O)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H33N3O3/c33-27-13-11-26(12-14-27)32(24-7-3-1-4-8-24,25-9-5-2-6-10-25)21-30(36)22-34-28-15-17-29(18-16-28)35-19-20-38-23-31(35)37/h1-18,30,34,36H,19-23,33H2/t30-/m0/s1 |
| InChIKey | SGRFIKSNLAGFQF-PMERELPUSA-N |
| XLogP | 4.83 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|