C26H32Cl2N4O8S — CID 118377688
bis[(2R)-1-chloro-3-[4-(3-oxomorpholin-4-yl)anilino]propan-2-yl] sulfate (PubChem CID 118377688) has the molecular formula C26H32Cl2N4O8S and a molecular weight of 631.54 g/mol. Its IUPAC name is bis[(2R)-1-chloro-3-[4-(3-oxomorpholin-4-yl)anilino]propan-2-yl] sulfate.
| Compound Name | bis[(2R)-1-chloro-3-[4-(3-oxomorpholin-4-yl)anilino]propan-2-yl] sulfate |
|---|---|
| PubChem CID | 118377688 |
| Molecular Formula | C26H32Cl2N4O8S |
| Molecular Weight | 631.54 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | bis[(2R)-1-chloro-3-[4-(3-oxomorpholin-4-yl)anilino]propan-2-yl] sulfate |
| SMILES | O=C1COCCN1c1ccc(NC[C@H](CCl)OS(=O)(=O)O[C@@H](CCl)CNc2ccc(N3CCOCC3=O)cc2)cc1 |
| InChI | InChI=1S/C26H32Cl2N4O8S/c27-13-23(15-29-19-1-5-21(6-2-19)31-9-11-37-17-25(31)33)39-41(35,36)40-24(14-28)16-30-20-3-7-22(8-4-20)32-10-12-38-18-26(32)34/h1-8,23-24,29-30H,9-18H2/t23-,24-/m0/s1 |
| InChIKey | DTZYGHVKBURRAH-ZEQRLZLVSA-N |
| XLogP | 2.43 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|