C19H21Cl2N3O5S — CID 118067168
5-chloro-N-[(2S)-3-chloro-2-[hydroxy-[4-(3-oxomorpholin-4-yl)anilino]methoxy]propyl]thiophene-2-carboxamide (PubChem CID 118067168) has the molecular formula C19H21Cl2N3O5S and a molecular weight of 474.37 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-3-chloro-2-[hydroxy-[4-(3-oxomorpholin-4-yl)anilino]methoxy]propyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[(2S)-3-chloro-2-[hydroxy-[4-(3-oxomorpholin-4-yl)anilino]methoxy]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 118067168 |
| Molecular Formula | C19H21Cl2N3O5S |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 5-chloro-N-[(2S)-3-chloro-2-[hydroxy-[4-(3-oxomorpholin-4-yl)anilino]methoxy]propyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@@H](CCl)OC(O)Nc1ccc(N2CCOCC2=O)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H21Cl2N3O5S/c20-9-14(10-22-18(26)15-5-6-16(21)30-15)29-19(27)23-12-1-3-13(4-2-12)24-7-8-28-11-17(24)25/h1-6,14,19,23,27H,7-11H2,(H,22,26)/t14-,19?/m1/s1 |
| InChIKey | YDFUROLYVHHODS-MJTSIZKDSA-N |
| XLogP | 2.51 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|