C18H19ClN4O5S — CID 171395174
5-chloro-N-[2-hydroxy-3-[N-nitroso-4-(3-oxomorpholin-4-yl)anilino]propyl]thiophene-2-carboxamide (PubChem CID 171395174) has the molecular formula C18H19ClN4O5S and a molecular weight of 438.89 g/mol. Its IUPAC name is 5-chloro-N-[2-hydroxy-3-[N-nitroso-4-(3-oxomorpholin-4-yl)anilino]propyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-hydroxy-3-[N-nitroso-4-(3-oxomorpholin-4-yl)anilino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 171395174 |
| Molecular Formula | C18H19ClN4O5S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 5-chloro-N-[2-hydroxy-3-[N-nitroso-4-(3-oxomorpholin-4-yl)anilino]propyl]thiophene-2-carboxamide |
| SMILES | O=NN(CC(O)CNC(=O)c1ccc(Cl)s1)c1ccc(N2CCOCC2=O)cc1 |
| InChI | InChI=1S/C18H19ClN4O5S/c19-16-6-5-15(29-16)18(26)20-9-14(24)10-23(21-27)13-3-1-12(2-4-13)22-7-8-28-11-17(22)25/h1-6,14,24H,7-11H2,(H,20,26) |
| InChIKey | NEDRUIYEGHLKOS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|