C18H21ClN4O4S — CID 21070772
N-[3-[3-amino-4-(3-oxomorpholin-4-yl)anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide (PubChem CID 21070772) has the molecular formula C18H21ClN4O4S and a molecular weight of 424.91 g/mol. Its IUPAC name is N-[3-[3-amino-4-(3-oxomorpholin-4-yl)anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[3-[3-amino-4-(3-oxomorpholin-4-yl)anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 21070772 |
| Molecular Formula | C18H21ClN4O4S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-[3-[3-amino-4-(3-oxomorpholin-4-yl)anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide |
| SMILES | Nc1cc(NCC(O)CNC(=O)c2ccc(Cl)s2)ccc1N1CCOCC1=O |
| InChI | InChI=1S/C18H21ClN4O4S/c19-16-4-3-15(28-16)18(26)22-9-12(24)8-21-11-1-2-14(13(20)7-11)23-5-6-27-10-17(23)25/h1-4,7,12,21,24H,5-6,8-10,20H2,(H,22,26) |
| InChIKey | MORAMQXLQFKNTC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|