C18H18AsClFN2O4S — CID 87690534
CID 87690534 (PubChem CID 87690534) has the molecular formula C18H18AsClFN2O4S and a molecular weight of 487.79 g/mol.
| Compound Name | CID 87690534 |
|---|---|
| PubChem CID | 87690534 |
| Molecular Formula | C18H18AsClFN2O4S |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | — |
| SMILES | O=C(NCC(O)C[As]c1ccc(N2CCOCC2=O)c(F)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H18AsClFN2O4S/c20-16-4-3-15(28-16)18(26)22-9-12(24)8-19-11-1-2-14(13(21)7-11)23-5-6-27-10-17(23)25/h1-4,7,12,24H,5-6,8-10H2,(H,22,26) |
| InChIKey | VEFIXWBYFIBLGH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|