C19H19Cl2N3O5S — CID 118060763
[(2S)-1-chloro-3-[(5-chlorothiophene-2-carbonyl)amino]propan-2-yl]-[4-(3-oxomorpholin-4-yl)phenyl]carbamic acid (PubChem CID 118060763) has the molecular formula C19H19Cl2N3O5S and a molecular weight of 472.35 g/mol. Its IUPAC name is [(2S)-1-chloro-3-[(5-chlorothiophene-2-carbonyl)amino]propan-2-yl]-[4-(3-oxomorpholin-4-yl)phenyl]carbamic acid.
| Compound Name | [(2S)-1-chloro-3-[(5-chlorothiophene-2-carbonyl)amino]propan-2-yl]-[4-(3-oxomorpholin-4-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 118060763 |
| Molecular Formula | C19H19Cl2N3O5S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | [(2S)-1-chloro-3-[(5-chlorothiophene-2-carbonyl)amino]propan-2-yl]-[4-(3-oxomorpholin-4-yl)phenyl]carbamic acid |
| SMILES | O=C(NC[C@@H](CCl)N(C(=O)O)c1ccc(N2CCOCC2=O)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H19Cl2N3O5S/c20-9-14(10-22-18(26)15-5-6-16(21)30-15)24(19(27)28)13-3-1-12(2-4-13)23-7-8-29-11-17(23)25/h1-6,14H,7-11H2,(H,22,26)(H,27,28)/t14-/m1/s1 |
| InChIKey | YMJVGCJKGLOEDU-CQSZACIVSA-N |
| XLogP | 3.29 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|