C19H19Cl2N3O5S — CID 90015492
[2-[(2S)-1-chloro-3-[(5-chlorothiophene-2-carbonyl)amino]propan-2-yl]-4-(3-oxomorpholin-4-yl)phenyl] carbamate (PubChem CID 90015492) has the molecular formula C19H19Cl2N3O5S and a molecular weight of 472.35 g/mol. Its IUPAC name is [2-[(2S)-1-chloro-3-[(5-chlorothiophene-2-carbonyl)amino]propan-2-yl]-4-(3-oxomorpholin-4-yl)phenyl] carbamate.
| Compound Name | [2-[(2S)-1-chloro-3-[(5-chlorothiophene-2-carbonyl)amino]propan-2-yl]-4-(3-oxomorpholin-4-yl)phenyl] carbamate |
|---|---|
| PubChem CID | 90015492 |
| Molecular Formula | C19H19Cl2N3O5S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | [2-[(2S)-1-chloro-3-[(5-chlorothiophene-2-carbonyl)amino]propan-2-yl]-4-(3-oxomorpholin-4-yl)phenyl] carbamate |
| SMILES | NC(=O)Oc1ccc(N2CCOCC2=O)cc1[C@H](CCl)CNC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H19Cl2N3O5S/c20-8-11(9-23-18(26)15-3-4-16(21)30-15)13-7-12(1-2-14(13)29-19(22)27)24-5-6-28-10-17(24)25/h1-4,7,11H,5-6,8-10H2,(H2,22,27)(H,23,26)/t11-/m1/s1 |
| InChIKey | JOWYAKJHEHHFOF-LLVKDONJSA-N |
| XLogP | 2.97 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|