C32H31FN4O8 — CID 161499223
2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione;2-[[(2S)-oxiran-2-yl]methyl]isoindole-1,3-dione;hydrofluoride (PubChem CID 161499223) has the molecular formula C32H31FN4O8 and a molecular weight of 618.62 g/mol. Its IUPAC name is 2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione;2-[[(2S)-oxiran-2-yl]methyl]isoindole-1,3-dione;hydrofluoride.
| Compound Name | 2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione;2-[[(2S)-oxiran-2-yl]methyl]isoindole-1,3-dione;hydrofluoride |
|---|---|
| PubChem CID | 161499223 |
| Molecular Formula | C32H31FN4O8 |
| Molecular Weight | 618.62 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | 2-[(2R)-2-hydroxy-3-[4-(3-oxomorpholin-4-yl)anilino]propyl]isoindole-1,3-dione;2-[[(2S)-oxiran-2-yl]methyl]isoindole-1,3-dione;hydrofluoride |
| SMILES | F.O=C1c2ccccc2C(=O)N1C[C@H](O)CNc1ccc(N2CCOCC2=O)cc1.O=C1c2ccccc2C(=O)N1C[C@H]1CO1 |
| InChI | InChI=1S/C21H21N3O5.C11H9NO3.FH/c25-16(12-24-20(27)17-3-1-2-4-18(17)21(24)28)11-22-14-5-7-15(8-6-14)23-9-10-29-13-19(23)26;13-10-8-3-1-2-4-9(8)11(14)12(10)5-7-6-15-7;/h1-8,16,22,25H,9-13H2;1-4,7H,5-6H2;1H/t16-;7-;/m10./s1 |
| InChIKey | WGPRDZVPFPZAIP-GMHCXTHMSA-N |
| XLogP | 1.95 |
| TPSA | 149.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.62 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|