C10H8N4O2 — CID 54070547
4-(1,3,5-triazin-2-ylamino)benzoic acid (PubChem CID 54070547) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is 4-(1,3,5-triazin-2-ylamino)benzoic acid.
| Compound Name | 4-(1,3,5-triazin-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 54070547 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 4-(1,3,5-triazin-2-ylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ncncn2)cc1 |
| InChI | InChI=1S/C10H8N4O2/c15-9(16)7-1-3-8(4-2-7)14-10-12-5-11-6-13-10/h1-6H,(H,15,16)(H,11,12,13,14) |
| InChIKey | MGCUYANAQOWCPB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |