C8H7N5 — CID 123186486
N-pyridin-4-yl-1,3,5-triazin-2-amine (PubChem CID 123186486) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is N-pyridin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-pyridin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123186486 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | N-pyridin-4-yl-1,3,5-triazin-2-amine |
| SMILES | c1cc(Nc2ncncn2)ccn1 |
| InChI | InChI=1S/C8H7N5/c1-3-9-4-2-7(1)13-8-11-5-10-6-12-8/h1-6H,(H,9,10,11,12,13) |
| InChIKey | FLJKLAWCSCUNTD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |