C12H10N6S — CID 42597046
3-N,5-N-dipyridin-4-yl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 42597046) has the molecular formula C12H10N6S and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-N,5-N-dipyridin-4-yl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 3-N,5-N-dipyridin-4-yl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 42597046 |
| Molecular Formula | C12H10N6S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-N,5-N-dipyridin-4-yl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | c1cc(Nc2nsc(Nc3ccncc3)n2)ccn1 |
| InChI | InChI=1S/C12H10N6S/c1-5-13-6-2-9(1)15-11-17-12(19-18-11)16-10-3-7-14-8-4-10/h1-8H,(H2,13,14,15,16,17,18) |
| InChIKey | PYLRKVOZUCZBLA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |