C12H9N5S — CID 155230364
N,3-dipyridin-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 155230364) has the molecular formula C12H9N5S and a molecular weight of 255.31 g/mol. Its IUPAC name is N,3-dipyridin-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N,3-dipyridin-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 155230364 |
| Molecular Formula | C12H9N5S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N,3-dipyridin-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | c1ccc(Nc2nc(-c3ccccn3)ns2)nc1 |
| InChI | InChI=1S/C12H9N5S/c1-3-7-13-9(5-1)11-16-12(18-17-11)15-10-6-2-4-8-14-10/h1-8H,(H,14,15,16,17) |
| InChIKey | OLMJHNLRKYRKPD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |