C13H16N6O — CID 90891336
2-morpholin-4-yl-4-N-(1,3,5-triazin-2-yl)benzene-1,4-diamine (PubChem CID 90891336) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-morpholin-4-yl-4-N-(1,3,5-triazin-2-yl)benzene-1,4-diamine.
| Compound Name | 2-morpholin-4-yl-4-N-(1,3,5-triazin-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 90891336 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-morpholin-4-yl-4-N-(1,3,5-triazin-2-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ncncn2)cc1N1CCOCC1 |
| InChI | InChI=1S/C13H16N6O/c14-11-2-1-10(18-13-16-8-15-9-17-13)7-12(11)19-3-5-20-6-4-19/h1-2,7-9H,3-6,14H2,(H,15,16,17,18) |
| InChIKey | IQZLCHGBHDUDLZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|