C16H19N5O2 — CID 86248826
N-(3,4-diaminophenyl)-6-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 86248826) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-(3,4-diaminophenyl)-6-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-(3,4-diaminophenyl)-6-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 86248826 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-(3,4-diaminophenyl)-6-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2ccc(N3CCOCC3)nc2)cc1N |
| InChI | InChI=1S/C16H19N5O2/c17-13-3-2-12(9-14(13)18)20-16(22)11-1-4-15(19-10-11)21-5-7-23-8-6-21/h1-4,9-10H,5-8,17-18H2,(H,20,22) |
| InChIKey | MPGDKKKATGGVLR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|