C18H22N4O4S — CID 31865595
N-[3-(dimethylsulfamoyl)phenyl]-6-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 31865595) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-6-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-6-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 31865595 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-6-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)c2ccc(N3CCOCC3)nc2)c1 |
| InChI | InChI=1S/C18H22N4O4S/c1-21(2)27(24,25)16-5-3-4-15(12-16)20-18(23)14-6-7-17(19-13-14)22-8-10-26-11-9-22/h3-7,12-13H,8-11H2,1-2H3,(H,20,23) |
| InChIKey | DOUAICMNNPGNIS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |