C23H31N5O5S — CID 55354482
2-[[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55354482) has the molecular formula C23H31N5O5S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-[[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55354482 |
| Molecular Formula | C23H31N5O5S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)CC(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C23H31N5O5S/c1-26(2)34(31,32)21-6-4-5-19(15-21)25-23(30)17-27(3)16-22(29)24-18-7-9-20(10-8-18)28-11-13-33-14-12-28/h4-10,15H,11-14,16-17H2,1-3H3,(H,24,29)(H,25,30) |
| InChIKey | WRMIMVHVQKZESI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|