C24H32N4O5S — CID 55328562
3-(diethylsulfamoyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide (PubChem CID 55328562) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55328562 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)N(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C24H32N4O5S/c1-4-28(5-2)34(31,32)22-8-6-7-19(17-22)24(30)26(3)18-23(29)25-20-9-11-21(12-10-20)27-13-15-33-16-14-27/h6-12,17H,4-5,13-16,18H2,1-3H3,(H,25,29) |
| InChIKey | GGNHOKZSUKGWTK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|