C20H22N4O4S — CID 7937740
2-[(3-cyanophenyl)sulfonyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 7937740) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-[(3-cyanophenyl)sulfonyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(3-cyanophenyl)sulfonyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 7937740 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-[(3-cyanophenyl)sulfonyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C20H22N4O4S/c1-23(29(26,27)19-4-2-3-16(13-19)14-21)15-20(25)22-17-5-7-18(8-6-17)24-9-11-28-12-10-24/h2-8,13H,9-12,15H2,1H3,(H,22,25) |
| InChIKey | BCGRBMDYUZRORD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|