C19H21F2N3O4S — CID 17398372
2-[(2,6-difluorophenyl)sulfonyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 17398372) has the molecular formula C19H21F2N3O4S and a molecular weight of 425.46 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)sulfonyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(2,6-difluorophenyl)sulfonyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17398372 |
| Molecular Formula | C19H21F2N3O4S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-[(2,6-difluorophenyl)sulfonyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C19H21F2N3O4S/c1-23(29(26,27)19-16(20)3-2-4-17(19)21)13-18(25)22-14-5-7-15(8-6-14)24-9-11-28-12-10-24/h2-8H,9-13H2,1H3,(H,22,25) |
| InChIKey | WDIOVZKIIWJQML-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|