C25H32FN5O3 — CID 55411344
2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55411344) has the molecular formula C25H32FN5O3 and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55411344 |
| Molecular Formula | C25H32FN5O3 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)CC(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H32FN5O3/c1-28(18-24(32)27-20-6-8-21(9-7-20)29-14-16-34-17-15-29)19-25(33)31-12-10-30(11-13-31)23-5-3-2-4-22(23)26/h2-9H,10-19H2,1H3,(H,27,32) |
| InChIKey | AZFPNAFRENZCAI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|