C17H22FN3O3 — CID 108943475
1-[4-(2-fluorophenyl)piperazin-1-yl]-3-morpholin-4-ylpropane-1,3-dione (PubChem CID 108943475) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)piperazin-1-yl]-3-morpholin-4-ylpropane-1,3-dione.
| Compound Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-3-morpholin-4-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 108943475 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-3-morpholin-4-ylpropane-1,3-dione |
| SMILES | O=C(CC(=O)N1CCN(c2ccccc2F)CC1)N1CCOCC1 |
| InChI | InChI=1S/C17H22FN3O3/c18-14-3-1-2-4-15(14)19-5-7-20(8-6-19)16(22)13-17(23)21-9-11-24-12-10-21/h1-4H,5-13H2 |
| InChIKey | FUCVGJHXGQZMMP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|